C25H22Cl2F3N9O4 — CID 155071669
5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(4-chloro-3-pyridinyl)-N-(1-formylpyrrolidin-3-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 155071669) has the molecular formula C25H22Cl2F3N9O4 and a molecular weight of 640.41 g/mol. Its IUPAC name is 5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(4-chloro-3-pyridinyl)-N-(1-formylpyrrolidin-3-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(4-chloro-3-pyridinyl)-N-(1-formylpyrrolidin-3-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155071669 |
| Molecular Formula | C25H22Cl2F3N9O4 |
| Molecular Weight | 640.41 g/mol |
| Exact Mass | 639.11 |
| IUPAC Name | 5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(4-chloro-3-pyridinyl)-N-(1-formylpyrrolidin-3-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=CN1CCC(NC(=O)c2nc(Cn3nc(-c4ccc(Cl)cc4)n(CC(O)C(F)(F)F)c3=O)nn2-c2cnccc2Cl)C1 |
| InChI | InChI=1S/C25H22Cl2F3N9O4/c26-15-3-1-14(2-4-15)21-35-38(24(43)37(21)11-19(41)25(28,29)30)12-20-33-22(23(42)32-16-6-8-36(10-16)13-40)39(34-20)18-9-31-7-5-17(18)27/h1-5,7,9,13,16,19,41H,6,8,10-12H2,(H,32,42) |
| InChIKey | FQMVSGIKHNVHBB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|