C16H28N4O5 — CID 155071950
[(4S)-5-[[(2S,4S)-5-amino-4-methyl-5-oxopentan-2-yl]amino]-4-(cyclopropanecarbonylamino)-5-oxopentyl]carbamic acid (PubChem CID 155071950) has the molecular formula C16H28N4O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(4S)-5-[[(2S,4S)-5-amino-4-methyl-5-oxopentan-2-yl]amino]-4-(cyclopropanecarbonylamino)-5-oxopentyl]carbamic acid.
| Compound Name | [(4S)-5-[[(2S,4S)-5-amino-4-methyl-5-oxopentan-2-yl]amino]-4-(cyclopropanecarbonylamino)-5-oxopentyl]carbamic acid |
|---|---|
| PubChem CID | 155071950 |
| Molecular Formula | C16H28N4O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [(4S)-5-[[(2S,4S)-5-amino-4-methyl-5-oxopentan-2-yl]amino]-4-(cyclopropanecarbonylamino)-5-oxopentyl]carbamic acid |
| SMILES | C[C@@H](C[C@H](C)C(N)=O)NC(=O)[C@H](CCCNC(=O)O)NC(=O)C1CC1 |
| InChI | InChI=1S/C16H28N4O5/c1-9(13(17)21)8-10(2)19-15(23)12(4-3-7-18-16(24)25)20-14(22)11-5-6-11/h9-12,18H,3-8H2,1-2H3,(H2,17,21)(H,19,23)(H,20,22)(H,24,25)/t9-,10-,12-/m0/s1 |
| InChIKey | SDQFWJDJJJHJAP-NHCYSSNCSA-N |
| XLogP | -0.05 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|