C11H20N4O6 — CID 138591868
[1-[(1-amino-2-methyl-1-oxopropan-2-yl)amino]-5-(carboxyamino)-1-oxopentan-2-yl]carbamic acid (PubChem CID 138591868) has the molecular formula C11H20N4O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is [1-[(1-amino-2-methyl-1-oxopropan-2-yl)amino]-5-(carboxyamino)-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [1-[(1-amino-2-methyl-1-oxopropan-2-yl)amino]-5-(carboxyamino)-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 138591868 |
| Molecular Formula | C11H20N4O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [1-[(1-amino-2-methyl-1-oxopropan-2-yl)amino]-5-(carboxyamino)-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)(NC(=O)C(CCCNC(=O)O)NC(=O)O)C(N)=O |
| InChI | InChI=1S/C11H20N4O6/c1-11(2,8(12)17)15-7(16)6(14-10(20)21)4-3-5-13-9(18)19/h6,13-14H,3-5H2,1-2H3,(H2,12,17)(H,15,16)(H,18,19)(H,20,21) |
| InChIKey | VWMYKDPUOTWGLY-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|