C10H18N4O6 — CID 138586594
[1-(2-acetylhydrazinyl)-6-(carboxyamino)-1-oxohexan-2-yl]carbamic acid (PubChem CID 138586594) has the molecular formula C10H18N4O6 and a molecular weight of 290.28 g/mol. Its IUPAC name is [1-(2-acetylhydrazinyl)-6-(carboxyamino)-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [1-(2-acetylhydrazinyl)-6-(carboxyamino)-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 138586594 |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [1-(2-acetylhydrazinyl)-6-(carboxyamino)-1-oxohexan-2-yl]carbamic acid |
| SMILES | CC(=O)NNC(=O)C(CCCCNC(=O)O)NC(=O)O |
| InChI | InChI=1S/C10H18N4O6/c1-6(15)13-14-8(16)7(12-10(19)20)4-2-3-5-11-9(17)18/h7,11-12H,2-5H2,1H3,(H,13,15)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | OFQVWYDKKIEWGQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|