C12H21N3O5S2 — CID 154942773
[(2S)-6-(carboxyamino)-1-(dithian-4-ylamino)-1-oxohexan-2-yl]carbamic acid (PubChem CID 154942773) has the molecular formula C12H21N3O5S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(2S)-6-(carboxyamino)-1-(dithian-4-ylamino)-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S)-6-(carboxyamino)-1-(dithian-4-ylamino)-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154942773 |
| Molecular Formula | C12H21N3O5S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [(2S)-6-(carboxyamino)-1-(dithian-4-ylamino)-1-oxohexan-2-yl]carbamic acid |
| SMILES | O=C(O)NCCCC[C@H](NC(=O)O)C(=O)NC1CCSSC1 |
| InChI | InChI=1S/C12H21N3O5S2/c16-10(14-8-4-6-21-22-7-8)9(15-12(19)20)3-1-2-5-13-11(17)18/h8-9,13,15H,1-7H2,(H,14,16)(H,17,18)(H,19,20)/t8?,9-/m0/s1 |
| InChIKey | XMBDKASDJBNNQC-GKAPJAKFSA-N |
| XLogP | 1.33 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|