C16H28N2O7S3 — CID 170392127
4-[5-(dithian-4-yl)pentanoylamino]-5-oxo-5-(2-sulfoethylamino)pentanoic acid (PubChem CID 170392127) has the molecular formula C16H28N2O7S3 and a molecular weight of 456.61 g/mol. Its IUPAC name is 4-[5-(dithian-4-yl)pentanoylamino]-5-oxo-5-(2-sulfoethylamino)pentanoic acid.
| Compound Name | 4-[5-(dithian-4-yl)pentanoylamino]-5-oxo-5-(2-sulfoethylamino)pentanoic acid |
|---|---|
| PubChem CID | 170392127 |
| Molecular Formula | C16H28N2O7S3 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[5-(dithian-4-yl)pentanoylamino]-5-oxo-5-(2-sulfoethylamino)pentanoic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCCC1CCSSC1)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C16H28N2O7S3/c19-14(4-2-1-3-12-7-9-26-27-11-12)18-13(5-6-15(20)21)16(22)17-8-10-28(23,24)25/h12-13H,1-11H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24,25) |
| InChIKey | YPHFYVAQTHLOQR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|