C8H11N3O3 — CID 155072759
9-hydroxy-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione (PubChem CID 155072759) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 9-hydroxy-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione.
| Compound Name | 9-hydroxy-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
|---|---|
| PubChem CID | 155072759 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 9-hydroxy-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
| SMILES | O=C1NCC2CC3CN(C(=O)N3O)C12 |
| InChI | InChI=1S/C8H11N3O3/c12-7-6-4(2-9-7)1-5-3-10(6)8(13)11(5)14/h4-6,14H,1-3H2,(H,9,12) |
| InChIKey | OWBIWXQBHVVZQZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|