C9H13N3O3 — CID 134363334
(2S,6S,8R)-9-hydroxy-4-methyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione (PubChem CID 134363334) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is (2S,6S,8R)-9-hydroxy-4-methyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione.
| Compound Name | (2S,6S,8R)-9-hydroxy-4-methyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
|---|---|
| PubChem CID | 134363334 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2S,6S,8R)-9-hydroxy-4-methyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
| SMILES | CN1C[C@@H]2C[C@@H]3CN(C(=O)N3O)[C@@H]2C1=O |
| InChI | InChI=1S/C9H13N3O3/c1-10-3-5-2-6-4-11(7(5)8(10)13)9(14)12(6)15/h5-7,15H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | PSYFLUFNRXXGQV-XVMARJQXSA-N |
| XLogP | -0.66 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|