C12H17N3O7 — CID 155074556
2-[2-[2-[(5-nitro-2-pyridinyl)oxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 155074556) has the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. Its IUPAC name is 2-[2-[2-[(5-nitro-2-pyridinyl)oxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[(5-nitro-2-pyridinyl)oxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 155074556 |
| Molecular Formula | C12H17N3O7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-[2-[(5-nitro-2-pyridinyl)oxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H17N3O7/c16-12(17)13-3-4-20-5-6-21-7-8-22-11-2-1-10(9-14-11)15(18)19/h1-2,9,13H,3-8H2,(H,16,17) |
| InChIKey | IFKVXSDWHRDBBB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|