C24H28O6 — CID 155076175
6-(3-methoxypropanoyloxy)hexyl 2-benzoylbenzoate (PubChem CID 155076175) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 6-(3-methoxypropanoyloxy)hexyl 2-benzoylbenzoate.
| Compound Name | 6-(3-methoxypropanoyloxy)hexyl 2-benzoylbenzoate |
|---|---|
| PubChem CID | 155076175 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 6-(3-methoxypropanoyloxy)hexyl 2-benzoylbenzoate |
| SMILES | COCCC(=O)OCCCCCCOC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28O6/c1-28-18-15-22(25)29-16-9-2-3-10-17-30-24(27)21-14-8-7-13-20(21)23(26)19-11-5-4-6-12-19/h4-8,11-14H,2-3,9-10,15-18H2,1H3 |
| InChIKey | NBQFAOKGVGRCOO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|