C21H22N8O2 — CID 155083668
2-(1,3-benzoxazol-2-ylamino)-N-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 155083668) has the molecular formula C21H22N8O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-N-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-N-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083668 |
| Molecular Formula | C21H22N8O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-N-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2nc3ccccc3o2)nc2cc(C(=O)NCCNC3=NCCN3)ccc21 |
| InChI | InChI=1S/C21H22N8O2/c1-29-16-7-6-13(18(30)22-8-9-23-19-24-10-11-25-19)12-15(16)26-20(29)28-21-27-14-4-2-3-5-17(14)31-21/h2-7,12H,8-11H2,1H3,(H,22,30)(H2,23,24,25)(H,26,27,28) |
| InChIKey | ZNLZPAWDNKESNC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|