C26H33N5O4Si — CID 155607715
2-[(6-acetyl-1,3-benzoxazol-2-yl)amino]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 155607715) has the molecular formula C26H33N5O4Si and a molecular weight of 507.67 g/mol. Its IUPAC name is 2-[(6-acetyl-1,3-benzoxazol-2-yl)amino]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-[(6-acetyl-1,3-benzoxazol-2-yl)amino]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155607715 |
| Molecular Formula | C26H33N5O4Si |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-[(6-acetyl-1,3-benzoxazol-2-yl)amino]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | CC(=O)c1ccc2nc(Nc3nc4cc(C(=O)NCCO[Si](C)(C)C(C)(C)C)ccc4n3C)oc2c1 |
| InChI | InChI=1S/C26H33N5O4Si/c1-16(32)17-8-10-19-22(15-17)35-25(29-19)30-24-28-20-14-18(9-11-21(20)31(24)5)23(33)27-12-13-34-36(6,7)26(2,3)4/h8-11,14-15H,12-13H2,1-7H3,(H,27,33)(H,28,29,30) |
| InChIKey | IDLIEROUEUNPBS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|