C18H18N6O3 — CID 155083567
N-(2-methoxyethyl)-1-methyl-2-([1,3]oxazolo[5,4-b]pyridin-2-ylamino)benzimidazole-5-carboxamide (PubChem CID 155083567) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-methyl-2-([1,3]oxazolo[5,4-b]pyridin-2-ylamino)benzimidazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-methyl-2-([1,3]oxazolo[5,4-b]pyridin-2-ylamino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083567 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(2-methoxyethyl)-1-methyl-2-([1,3]oxazolo[5,4-b]pyridin-2-ylamino)benzimidazole-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)nc(Nc1nc3cccnc3o1)n2C |
| InChI | InChI=1S/C18H18N6O3/c1-24-14-6-5-11(15(25)19-8-9-26-2)10-13(14)21-17(24)23-18-22-12-4-3-7-20-16(12)27-18/h3-7,10H,8-9H2,1-2H3,(H,19,25)(H,21,22,23) |
| InChIKey | OSMARDMHMRLDLU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|