C31H36N4O3 — CID 155085021
1-[(2S)-2-methyl-3-[4-[5-[4-(5-methylhexyl)phenyl]pyrimidin-2-yl]phenyl]propanoyl]-N-oxoazetidine-3-carboxamide (PubChem CID 155085021) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-3-[4-[5-[4-(5-methylhexyl)phenyl]pyrimidin-2-yl]phenyl]propanoyl]-N-oxoazetidine-3-carboxamide.
| Compound Name | 1-[(2S)-2-methyl-3-[4-[5-[4-(5-methylhexyl)phenyl]pyrimidin-2-yl]phenyl]propanoyl]-N-oxoazetidine-3-carboxamide |
|---|---|
| PubChem CID | 155085021 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 1-[(2S)-2-methyl-3-[4-[5-[4-(5-methylhexyl)phenyl]pyrimidin-2-yl]phenyl]propanoyl]-N-oxoazetidine-3-carboxamide |
| SMILES | CC(C)CCCCc1ccc(-c2cnc(-c3ccc(C[C@H](C)C(=O)N4CC(C(=O)N=O)C4)cc3)nc2)cc1 |
| InChI | InChI=1S/C31H36N4O3/c1-21(2)6-4-5-7-23-8-12-25(13-9-23)27-17-32-29(33-18-27)26-14-10-24(11-15-26)16-22(3)31(37)35-19-28(20-35)30(36)34-38/h8-15,17-18,21-22,28H,4-7,16,19-20H2,1-3H3/t22-/m0/s1 |
| InChIKey | INWGLNZEXRRFIA-QFIPXVFZSA-N |
| XLogP | 6.11 |
| TPSA | 92.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|