C6H10FN — CID 155086858
(1E,3Z)-1-fluoro-N-methylpenta-1,3-dien-1-amine (PubChem CID 155086858) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is (1E,3Z)-1-fluoro-N-methylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-1-fluoro-N-methylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155086858 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | (1E,3Z)-1-fluoro-N-methylpenta-1,3-dien-1-amine |
| SMILES | C/C=C\C=C(\F)NC |
| InChI | InChI=1S/C6H10FN/c1-3-4-5-6(7)8-2/h3-5,8H,1-2H3/b4-3-,6-5- |
| InChIKey | BJGASXPWLDJXFQ-OUPQRBNQSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|