C40H18F4O2S2 — CID 155086901
13,28-bis(3,5-difluorophenyl)-5λ6,20-dithiaoctacyclo[14.14.0.03,14.04,12.06,11.018,29.019,27.021,26]triaconta-1(30),2,4(12),6,8,10,13,15,17,19(27),21,23,25,28-tetradecaene 5,5-dioxide (PubChem CID 155086901) has the molecular formula C40H18F4O2S2 and a molecular weight of 670.71 g/mol. Its IUPAC name is 13,28-bis(3,5-difluorophenyl)-5λ6,20-dithiaoctacyclo[14.14.0.03,14.04,12.06,11.018,29.019,27.021,26]triaconta-1(30),2,4(12),6,8,10,13,15,17,19(27),21,23,25,28-tetradecaene 5,5-dioxide.
| Compound Name | 13,28-bis(3,5-difluorophenyl)-5λ6,20-dithiaoctacyclo[14.14.0.03,14.04,12.06,11.018,29.019,27.021,26]triaconta-1(30),2,4(12),6,8,10,13,15,17,19(27),21,23,25,28-tetradecaene 5,5-dioxide |
|---|---|
| PubChem CID | 155086901 |
| Molecular Formula | C40H18F4O2S2 |
| Molecular Weight | 670.71 g/mol |
| Exact Mass | 670.07 |
| IUPAC Name | 13,28-bis(3,5-difluorophenyl)-5λ6,20-dithiaoctacyclo[14.14.0.03,14.04,12.06,11.018,29.019,27.021,26]triaconta-1(30),2,4(12),6,8,10,13,15,17,19(27),21,23,25,28-tetradecaene 5,5-dioxide |
| SMILES | O=S1(=O)C2=C(C(c3cc(F)cc(F)c3)=c3cc4cc5c(cc4cc32)=C(c2cc(F)cc(F)c2)c2c-5sc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C40H18F4O2S2/c41-23-9-21(10-24(42)17-23)35-29-13-20-16-32-30(14-19(20)15-31(29)39-37(35)27-5-1-3-7-33(27)47-39)36(22-11-25(43)18-26(44)12-22)38-28-6-2-4-8-34(28)48(45,46)40(32)38/h1-18H |
| InChIKey | PWPQJOKBYJWKFN-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.71 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|