C19H12Cl2N2O2 — CID 155087016
5-[(3,4-dichlorophenyl)-quinolin-6-yloxymethyl]-1,3-oxazole (PubChem CID 155087016) has the molecular formula C19H12Cl2N2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)-quinolin-6-yloxymethyl]-1,3-oxazole.
| Compound Name | 5-[(3,4-dichlorophenyl)-quinolin-6-yloxymethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 155087016 |
| Molecular Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)-quinolin-6-yloxymethyl]-1,3-oxazole |
| SMILES | Clc1ccc(C(Oc2ccc3ncccc3c2)c2cnco2)cc1Cl |
| InChI | InChI=1S/C19H12Cl2N2O2/c20-15-5-3-13(9-16(15)21)19(18-10-22-11-24-18)25-14-4-6-17-12(8-14)2-1-7-23-17/h1-11,19H |
| InChIKey | HCJOYWIVPTUZQF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |