C17H23N3O3 — CID 155091692
tert-butyl N-[(1E)-1-[[C,N-bis(ethenyl)carbonimidoyl]-prop-2-enoylamino]buta-1,3-dien-2-yl]carbamate (PubChem CID 155091692) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[(1E)-1-[[C,N-bis(ethenyl)carbonimidoyl]-prop-2-enoylamino]buta-1,3-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1E)-1-[[C,N-bis(ethenyl)carbonimidoyl]-prop-2-enoylamino]buta-1,3-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 155091692 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[(1E)-1-[[C,N-bis(ethenyl)carbonimidoyl]-prop-2-enoylamino]buta-1,3-dien-2-yl]carbamate |
| SMILES | C=C/N=C(\C=C)N(/C=C(\C=C)NC(=O)OC(C)(C)C)C(=O)C=C |
| InChI | InChI=1S/C17H23N3O3/c1-8-13(19-16(22)23-17(5,6)7)12-20(15(21)10-3)14(9-2)18-11-4/h8-12H,1-4H2,5-7H3,(H,19,22)/b13-12+,18-14+ |
| InChIKey | WEMWGIYECLFRNF-MEAXDALNSA-N |
| XLogP | 3.28 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|