C13H12F3N3O4 — CID 155092527
[3-[[5-(trifluoromethoxy)-2-pyridinyl]carbamoyl]-1-bicyclo[1.1.1]pentanyl]carbamic acid (PubChem CID 155092527) has the molecular formula C13H12F3N3O4 and a molecular weight of 331.25 g/mol. Its IUPAC name is [3-[[5-(trifluoromethoxy)-2-pyridinyl]carbamoyl]-1-bicyclo[1.1.1]pentanyl]carbamic acid.
| Compound Name | [3-[[5-(trifluoromethoxy)-2-pyridinyl]carbamoyl]-1-bicyclo[1.1.1]pentanyl]carbamic acid |
|---|---|
| PubChem CID | 155092527 |
| Molecular Formula | C13H12F3N3O4 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [3-[[5-(trifluoromethoxy)-2-pyridinyl]carbamoyl]-1-bicyclo[1.1.1]pentanyl]carbamic acid |
| SMILES | O=C(O)NC12CC(C(=O)Nc3ccc(OC(F)(F)F)cn3)(C1)C2 |
| InChI | InChI=1S/C13H12F3N3O4/c14-13(15,16)23-7-1-2-8(17-3-7)18-9(20)11-4-12(5-11,6-11)19-10(21)22/h1-3,19H,4-6H2,(H,21,22)(H,17,18,20) |
| InChIKey | LAHNGRWIIHQWGG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |