C28H36O7 — CID 155093715
ditert-butyl 2-[(3-methoxycarbonyl-5-phenylmethoxyphenyl)methyl]butanedioate (PubChem CID 155093715) has the molecular formula C28H36O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is ditert-butyl 2-[(3-methoxycarbonyl-5-phenylmethoxyphenyl)methyl]butanedioate.
| Compound Name | ditert-butyl 2-[(3-methoxycarbonyl-5-phenylmethoxyphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 155093715 |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | ditert-butyl 2-[(3-methoxycarbonyl-5-phenylmethoxyphenyl)methyl]butanedioate |
| SMILES | COC(=O)c1cc(CC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H36O7/c1-27(2,3)34-24(29)17-22(26(31)35-28(4,5)6)14-20-13-21(25(30)32-7)16-23(15-20)33-18-19-11-9-8-10-12-19/h8-13,15-16,22H,14,17-18H2,1-7H3 |
| InChIKey | JYKWNEYJLCHGKN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|