C37H55NO9Si — CID 142579077
ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[[3-phenylmethoxy-5-(2-trimethylsilylethoxycarbonyl)phenyl]methyl]amino]butanedioate (PubChem CID 142579077) has the molecular formula C37H55NO9Si and a molecular weight of 685.93 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[[3-phenylmethoxy-5-(2-trimethylsilylethoxycarbonyl)phenyl]methyl]amino]butanedioate.
| Compound Name | ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[[3-phenylmethoxy-5-(2-trimethylsilylethoxycarbonyl)phenyl]methyl]amino]butanedioate |
|---|---|
| PubChem CID | 142579077 |
| Molecular Formula | C37H55NO9Si |
| Molecular Weight | 685.93 g/mol |
| Exact Mass | 685.36 |
| IUPAC Name | ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[[3-phenylmethoxy-5-(2-trimethylsilylethoxycarbonyl)phenyl]methyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC(C)(C)C)N(Cc1cc(OCc2ccccc2)cc(C(=O)OCC[Si](C)(C)C)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H55NO9Si/c1-35(2,3)45-31(39)23-30(33(41)46-36(4,5)6)38(34(42)47-37(7,8)9)24-27-20-28(32(40)43-18-19-48(10,11)12)22-29(21-27)44-25-26-16-14-13-15-17-26/h13-17,20-22,30H,18-19,23-25H2,1-12H3/t30-/m0/s1 |
| InChIKey | QMUIROPFLHCBIV-PMERELPUSA-N |
| XLogP | 7.94 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.93 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|