C25H41NO6Si — CID 142578895
ditert-butyl (2S)-2-[[3-(2-trimethylsilylethoxycarbonyl)phenyl]methylamino]butanedioate (PubChem CID 142578895) has the molecular formula C25H41NO6Si and a molecular weight of 479.69 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[3-(2-trimethylsilylethoxycarbonyl)phenyl]methylamino]butanedioate.
| Compound Name | ditert-butyl (2S)-2-[[3-(2-trimethylsilylethoxycarbonyl)phenyl]methylamino]butanedioate |
|---|---|
| PubChem CID | 142578895 |
| Molecular Formula | C25H41NO6Si |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | ditert-butyl (2S)-2-[[3-(2-trimethylsilylethoxycarbonyl)phenyl]methylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NCc1cccc(C(=O)OCC[Si](C)(C)C)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H41NO6Si/c1-24(2,3)31-21(27)16-20(23(29)32-25(4,5)6)26-17-18-11-10-12-19(15-18)22(28)30-13-14-33(7,8)9/h10-12,15,20,26H,13-14,16-17H2,1-9H3/t20-/m0/s1 |
| InChIKey | STKNDWKDXXRCJM-FQEVSTJZSA-N |
| XLogP | 4.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|