C26H36N2O3 — CID 54762942
tert-butyl 3-[[propan-2-yl-[3-[(propan-2-ylamino)methyl]benzoyl]amino]methyl]benzoate (PubChem CID 54762942) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl 3-[[propan-2-yl-[3-[(propan-2-ylamino)methyl]benzoyl]amino]methyl]benzoate.
| Compound Name | tert-butyl 3-[[propan-2-yl-[3-[(propan-2-ylamino)methyl]benzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 54762942 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | tert-butyl 3-[[propan-2-yl-[3-[(propan-2-ylamino)methyl]benzoyl]amino]methyl]benzoate |
| SMILES | CC(C)NCc1cccc(C(=O)N(Cc2cccc(C(=O)OC(C)(C)C)c2)C(C)C)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-18(2)27-16-20-10-8-12-22(14-20)24(29)28(19(3)4)17-21-11-9-13-23(15-21)25(30)31-26(5,6)7/h8-15,18-19,27H,16-17H2,1-7H3 |
| InChIKey | YRUNOJKWIVXGRT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |