C24H31NO4 — CID 54021429
methyl 3-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2-methylpropyl)anilino]methyl]benzoate (PubChem CID 54021429) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl 3-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2-methylpropyl)anilino]methyl]benzoate.
| Compound Name | methyl 3-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2-methylpropyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 54021429 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | methyl 3-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2-methylpropyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN(C(=O)OC(C)(C)C)c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C24H31NO4/c1-17(2)14-18-10-12-21(13-11-18)25(23(27)29-24(3,4)5)16-19-8-7-9-20(15-19)22(26)28-6/h7-13,15,17H,14,16H2,1-6H3 |
| InChIKey | KZENBAMKGYZONN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |