C18H20N11O11P — CID 155093976
[(1R,3R,4R,5R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl] hydrogen phosphate (PubChem CID 155093976) has the molecular formula C18H20N11O11P and a molecular weight of 597.40 g/mol. Its IUPAC name is [(1R,3R,4R,5R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl] hydrogen phosphate.
| Compound Name | [(1R,3R,4R,5R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 155093976 |
| Molecular Formula | C18H20N11O11P |
| Molecular Weight | 597.40 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | [(1R,3R,4R,5R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@H]3C(O)[C@]3(O)[C@H]2OP(=O)(O)O[C@H]2O[C@@H](n3nnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H20N11O11P/c19-10-3-11(22-1-21-10)29(27-26-3)14-5(30)6(31)16(38-14)40-41(35,36)39-9-15(37-8-7(32)18(8,9)34)28-2-23-4-12(28)24-17(20)25-13(4)33/h1-2,5-9,14-16,30-32,34H,(H,35,36)(H2,19,21,22)(H3,20,24,25,33)/t5-,6+,7?,8-,9+,14-,15-,16-,18-/m1/s1 |
| InChIKey | WEGMQBGCABLSTO-OIGQIBLSSA-N |
| XLogP | -4.40 |
| TPSA | 327.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.40 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|