About 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate
1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate (PubChem CID 155094676) has the molecular formula C9H15N3O2S
and a molecular weight of 229.31 g/mol. Its IUPAC name is 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate.
Molecular Properties
| Compound Name | 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate |
| PubChem CID | 155094676 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate |
| SMILES | CC(S)OC(=O)Cn1cc(C(C)C)nn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6(2)8-4-12(11-10-8)5-9(13)14-7(3)15/h4,6-7,15H,5H2,1-3H3 |
| InChIKey | BTJHTVDCFWTURZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate?
The IUPAC name of 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate (CID 155094676) is 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate.
What is the SMILES notation for 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate?
The canonical SMILES for 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate is CC(S)OC(=O)Cn1cc(C(C)C)nn1.
What is the InChIKey of 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate?
The InChIKey is BTJHTVDCFWTURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-6(2)8-4-12(11-10-8)5-9(13)14-7(3)15/h4,6-7,15H,5H2,1-3H3.
What are the key properties of 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate?
1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate has a molecular weight of 229.31 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylethyl 2-(4-propan-2-yltriazol-1-yl)acetate is sourced from PubChem (CID 155094676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).