C11H22N4O — CID 160921955
methane;2-methyl-N-[(4-propan-2-yltriazol-1-yl)methyl]propanamide (PubChem CID 160921955) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is methane;2-methyl-N-[(4-propan-2-yltriazol-1-yl)methyl]propanamide.
| Compound Name | methane;2-methyl-N-[(4-propan-2-yltriazol-1-yl)methyl]propanamide |
|---|---|
| PubChem CID | 160921955 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | methane;2-methyl-N-[(4-propan-2-yltriazol-1-yl)methyl]propanamide |
| SMILES | C.CC(C)C(=O)NCn1cc(C(C)C)nn1 |
| InChI | InChI=1S/C10H18N4O.CH4/c1-7(2)9-5-14(13-12-9)6-11-10(15)8(3)4;/h5,7-8H,6H2,1-4H3,(H,11,15);1H4 |
| InChIKey | SSDNIVQUHPNYJZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |