C27H36N4O3 — CID 155102320
(2S)-2-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-morpholin-4-ylphenyl)acetaldehyde (PubChem CID 155102320) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S)-2-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-morpholin-4-ylphenyl)acetaldehyde.
| Compound Name | (2S)-2-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-morpholin-4-ylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 155102320 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (2S)-2-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-morpholin-4-ylphenyl)acetaldehyde |
| SMILES | COc1ccc(N2CCN(C)CC2)c2c1CCN([C@H](C=O)c1ccc(N3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C27H36N4O3/c1-28-11-13-30(14-12-28)25-7-8-27(33-2)23-9-10-31(19-24(23)25)26(20-32)21-3-5-22(6-4-21)29-15-17-34-18-16-29/h3-8,20,26H,9-19H2,1-2H3/t26-/m1/s1 |
| InChIKey | YIIYQBXRXKOZPP-AREMUKBSSA-N |
| XLogP | 2.58 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|