C23H33N5O2 — CID 69447447
2-(4-aminophenyl)-1-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;azane (PubChem CID 69447447) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;azane.
| Compound Name | 2-(4-aminophenyl)-1-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;azane |
|---|---|
| PubChem CID | 69447447 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-(4-aminophenyl)-1-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;azane |
| SMILES | COc1ccc(N2CCN(C)CC2)c2c1CCN(C(=O)Cc1ccc(N)cc1)C2.N |
| InChI | InChI=1S/C23H30N4O2.H3N/c1-25-11-13-26(14-12-25)21-7-8-22(29-2)19-9-10-27(16-20(19)21)23(28)15-17-3-5-18(24)6-4-17;/h3-8H,9-16,24H2,1-2H3;1H3 |
| InChIKey | FWAJUJLQGLQHKG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|