C27H36N4O3 — CID 58794062
N-[5-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-oxopentyl]benzamide (PubChem CID 58794062) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[5-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-oxopentyl]benzamide.
| Compound Name | N-[5-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 58794062 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[5-[5-methoxy-8-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-oxopentyl]benzamide |
| SMILES | COc1ccc(N2CCN(C)CC2)c2c1CCN(C(=O)CCCCNC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C27H36N4O3/c1-29-16-18-30(19-17-29)24-11-12-25(34-2)22-13-15-31(20-23(22)24)26(32)10-6-7-14-28-27(33)21-8-4-3-5-9-21/h3-5,8-9,11-12H,6-7,10,13-20H2,1-2H3,(H,28,33) |
| InChIKey | WHJZKYHMAFEQGO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|