C15H18N4 — CID 155102612
4-cyclopentyl-6-pyridin-3-ylpyridine-2,3-diamine (PubChem CID 155102612) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-cyclopentyl-6-pyridin-3-ylpyridine-2,3-diamine.
| Compound Name | 4-cyclopentyl-6-pyridin-3-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 155102612 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-cyclopentyl-6-pyridin-3-ylpyridine-2,3-diamine |
| SMILES | Nc1nc(-c2cccnc2)cc(C2CCCC2)c1N |
| InChI | InChI=1S/C15H18N4/c16-14-12(10-4-1-2-5-10)8-13(19-15(14)17)11-6-3-7-18-9-11/h3,6-10H,1-2,4-5,16H2,(H2,17,19) |
| InChIKey | XBFRQFVFZUPOFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |