C17H21N3 — CID 155102511
4-cyclopentyl-6-(4-methylphenyl)pyridine-2,3-diamine (PubChem CID 155102511) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-cyclopentyl-6-(4-methylphenyl)pyridine-2,3-diamine.
| Compound Name | 4-cyclopentyl-6-(4-methylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 155102511 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-cyclopentyl-6-(4-methylphenyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(-c2cc(C3CCCC3)c(N)c(N)n2)cc1 |
| InChI | InChI=1S/C17H21N3/c1-11-6-8-13(9-7-11)15-10-14(12-4-2-3-5-12)16(18)17(19)20-15/h6-10,12H,2-5,18H2,1H3,(H2,19,20) |
| InChIKey | QOJMONXCHAKYMI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |