C25H25N3 — CID 25108942
2-cyclohexyl-7-(4-methylphenyl)-5-phenyl-1H-imidazo[4,5-b]pyridine (PubChem CID 25108942) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-cyclohexyl-7-(4-methylphenyl)-5-phenyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-cyclohexyl-7-(4-methylphenyl)-5-phenyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 25108942 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-cyclohexyl-7-(4-methylphenyl)-5-phenyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc3nc(C4CCCCC4)[nH]c23)cc1 |
| InChI | InChI=1S/C25H25N3/c1-17-12-14-18(15-13-17)21-16-22(19-8-4-2-5-9-19)26-25-23(21)27-24(28-25)20-10-6-3-7-11-20/h2,4-5,8-9,12-16,20H,3,6-7,10-11H2,1H3,(H,26,27,28) |
| InChIKey | ZDIIDPYWYZPZHG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |