C19H15N3 — CID 25108874
5-(4-methylphenyl)-7-phenyl-1H-imidazo[4,5-b]pyridine (PubChem CID 25108874) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-(4-methylphenyl)-7-phenyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-(4-methylphenyl)-7-phenyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 25108874 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-(4-methylphenyl)-7-phenyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C19H15N3/c1-13-7-9-15(10-8-13)17-11-16(14-5-3-2-4-6-14)18-19(22-17)21-12-20-18/h2-12H,1H3,(H,20,21,22) |
| InChIKey | AXPTVTLMOWKBFQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |