C21H21ClN8O6 — CID 155103095
[6-chloro-3-[4-(5-methoxy-6-nitroindazol-1-yl)butan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid (PubChem CID 155103095) has the molecular formula C21H21ClN8O6 and a molecular weight of 516.90 g/mol. Its IUPAC name is [6-chloro-3-[4-(5-methoxy-6-nitroindazol-1-yl)butan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid.
| Compound Name | [6-chloro-3-[4-(5-methoxy-6-nitroindazol-1-yl)butan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 155103095 |
| Molecular Formula | C21H21ClN8O6 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | [6-chloro-3-[4-(5-methoxy-6-nitroindazol-1-yl)butan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid |
| SMILES | COc1cc2cnn(CCC(C)NC(=O)c3cnc4c(N(C)C(=O)O)cc(Cl)nn34)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21ClN8O6/c1-11(4-5-28-13-7-14(30(34)35)17(36-3)6-12(13)9-24-28)25-20(31)16-10-23-19-15(27(2)21(32)33)8-18(22)26-29(16)19/h6-11H,4-5H2,1-3H3,(H,25,31)(H,32,33) |
| InChIKey | OJFSYEBHIHYWND-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|