C9H20N2 — CID 155106551
1-N'-[(E)-hex-3-en-3-yl]-1-N'-methylethane-1,1-diamine (PubChem CID 155106551) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-N'-[(E)-hex-3-en-3-yl]-1-N'-methylethane-1,1-diamine.
| Compound Name | 1-N'-[(E)-hex-3-en-3-yl]-1-N'-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 155106551 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-N'-[(E)-hex-3-en-3-yl]-1-N'-methylethane-1,1-diamine |
| SMILES | CC/C=C(\CC)N(C)C(C)N |
| InChI | InChI=1S/C9H20N2/c1-5-7-9(6-2)11(4)8(3)10/h7-8H,5-6,10H2,1-4H3/b9-7+ |
| InChIKey | MEKOIJYZVDLYNP-VQHVLOKHSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|