C17H22O9 — CID 155111984
(1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-1-hydroxy-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid (PubChem CID 155111984) has the molecular formula C17H22O9 and a molecular weight of 370.35 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-1-hydroxy-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-1-hydroxy-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155111984 |
| Molecular Formula | C17H22O9 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-1-hydroxy-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(/C=C/C(O)O[C@@H]2C[C@](O)(C(=O)O)C[C@@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C17H22O9/c1-25-12-4-2-9(6-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13-15,18-21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,14?,15-,17+/m1/s1 |
| InChIKey | JQLPZQCBUZQTMC-FKXFWEAZSA-N |
| XLogP | -0.55 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|