C62H52N2S2 — CID 155119360
N,N-diphenyl-4-[2-[6-[2-[4-(N-phenylanilino)phenyl]ethynyl]-3,8-bis(trimethyl-λ4-sulfanyl)pyren-1-yl]ethynyl]aniline (PubChem CID 155119360) has the molecular formula C62H52N2S2 and a molecular weight of 889.25 g/mol. Its IUPAC name is N,N-diphenyl-4-[2-[6-[2-[4-(N-phenylanilino)phenyl]ethynyl]-3,8-bis(trimethyl-λ4-sulfanyl)pyren-1-yl]ethynyl]aniline.
| Compound Name | N,N-diphenyl-4-[2-[6-[2-[4-(N-phenylanilino)phenyl]ethynyl]-3,8-bis(trimethyl-λ4-sulfanyl)pyren-1-yl]ethynyl]aniline |
|---|---|
| PubChem CID | 155119360 |
| Molecular Formula | C62H52N2S2 |
| Molecular Weight | 889.25 g/mol |
| Exact Mass | 888.36 |
| IUPAC Name | N,N-diphenyl-4-[2-[6-[2-[4-(N-phenylanilino)phenyl]ethynyl]-3,8-bis(trimethyl-λ4-sulfanyl)pyren-1-yl]ethynyl]aniline |
| SMILES | CS(C)(C)c1cc(C#Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)c2ccc3c(S(C)(C)C)cc(C#Cc4ccc(N(c5ccccc5)c5ccccc5)cc4)c4ccc1c2c43 |
| InChI | InChI=1S/C62H52N2S2/c1-65(2,3)59-43-47(33-27-45-29-35-53(36-30-45)63(49-19-11-7-12-20-49)50-21-13-8-14-22-50)55-40-42-58-60(66(4,5)6)44-48(56-39-41-57(59)61(55)62(56)58)34-28-46-31-37-54(38-32-46)64(51-23-15-9-16-24-51)52-25-17-10-18-26-52/h7-26,29-32,35-44H,1-6H3 |
| InChIKey | CBFCUMWULZHAAK-UHFFFAOYSA-N |
| XLogP | 16.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.25 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|