C11H11ClFNO — CID 155122003
6-chloro-7-fluoro-4-methoxy-1,2-dimethylindole (PubChem CID 155122003) has the molecular formula C11H11ClFNO and a molecular weight of 227.67 g/mol. Its IUPAC name is 6-chloro-7-fluoro-4-methoxy-1,2-dimethylindole.
| Compound Name | 6-chloro-7-fluoro-4-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 155122003 |
| Molecular Formula | C11H11ClFNO |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 6-chloro-7-fluoro-4-methoxy-1,2-dimethylindole |
| SMILES | COc1cc(Cl)c(F)c2c1cc(C)n2C |
| InChI | InChI=1S/C11H11ClFNO/c1-6-4-7-9(15-3)5-8(12)10(13)11(7)14(6)2/h4-5H,1-3H3 |
| InChIKey | XSTMDDMYGAMLDM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |