C23H28N2O2 — CID 155124421
9-(3,3-dimethylbut-1-ynyl)-2-(oxolan-2-ylmethoxy)-6,7-dihydro-4H-pyrimido[6,1-a]isoquinoline (PubChem CID 155124421) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 9-(3,3-dimethylbut-1-ynyl)-2-(oxolan-2-ylmethoxy)-6,7-dihydro-4H-pyrimido[6,1-a]isoquinoline.
| Compound Name | 9-(3,3-dimethylbut-1-ynyl)-2-(oxolan-2-ylmethoxy)-6,7-dihydro-4H-pyrimido[6,1-a]isoquinoline |
|---|---|
| PubChem CID | 155124421 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 9-(3,3-dimethylbut-1-ynyl)-2-(oxolan-2-ylmethoxy)-6,7-dihydro-4H-pyrimido[6,1-a]isoquinoline |
| SMILES | CC(C)(C)C#Cc1ccc2c(c1)CCN1CN=C(OCC3CCCO3)C=C21 |
| InChI | InChI=1S/C23H28N2O2/c1-23(2,3)10-8-17-6-7-20-18(13-17)9-11-25-16-24-22(14-21(20)25)27-15-19-5-4-12-26-19/h6-7,13-14,19H,4-5,9,11-12,15-16H2,1-3H3 |
| InChIKey | TVJZXWJIRAWAFW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|