C29H30N2O3 — CID 76684898
9-[4-(3,3-dimethylbut-1-ynyl)phenyl]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 76684898) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 9-[4-(3,3-dimethylbut-1-ynyl)phenyl]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9-[4-(3,3-dimethylbut-1-ynyl)phenyl]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 76684898 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 9-[4-(3,3-dimethylbut-1-ynyl)phenyl]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | CC(C)(C)C#Cc1ccc(-c2ccc3c(c2)CCn2c-3cc(OCC3CCCO3)nc2=O)cc1 |
| InChI | InChI=1S/C29H30N2O3/c1-29(2,3)14-12-20-6-8-21(9-7-20)22-10-11-25-23(17-22)13-15-31-26(25)18-27(30-28(31)32)34-19-24-5-4-16-33-24/h6-11,17-18,24H,4-5,13,15-16,19H2,1-3H3 |
| InChIKey | DOEHHEWWMDQYJT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|