C18H20N2O6S — CID 118875305
[4-oxo-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl] methanesulfonate (PubChem CID 118875305) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is [4-oxo-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl] methanesulfonate.
| Compound Name | [4-oxo-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 118875305 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [4-oxo-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)CCn1c-2cc(OCC2CCCO2)nc1=O |
| InChI | InChI=1S/C18H20N2O6S/c1-27(22,23)26-13-4-5-15-12(9-13)6-7-20-16(15)10-17(19-18(20)21)25-11-14-3-2-8-24-14/h4-5,9-10,14H,2-3,6-8,11H2,1H3 |
| InChIKey | NAVSJABUTIOZED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|