C24H30N2O5 — CID 167136265
9-(3-cyclopropylpropoxy)-2-[2-(1,4-dioxan-2-yl)ethoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 167136265) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 9-(3-cyclopropylpropoxy)-2-[2-(1,4-dioxan-2-yl)ethoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9-(3-cyclopropylpropoxy)-2-[2-(1,4-dioxan-2-yl)ethoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 167136265 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 9-(3-cyclopropylpropoxy)-2-[2-(1,4-dioxan-2-yl)ethoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | O=c1nc(OCCC2COCCO2)cc2n1CCc1cc(OCCCC3CC3)ccc1-2 |
| InChI | InChI=1S/C24H30N2O5/c27-24-25-23(31-11-8-20-16-28-12-13-30-20)15-22-21-6-5-19(14-18(21)7-9-26(22)24)29-10-1-2-17-3-4-17/h5-6,14-15,17,20H,1-4,7-13,16H2 |
| InChIKey | OYPGPOXQSLDWRE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|