C23H30N2O6 — CID 130413276
2-[2-(1,4-dioxan-2-yl)ethoxy]-9-(2-propoxyethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 130413276) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[2-(1,4-dioxan-2-yl)ethoxy]-9-(2-propoxyethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-[2-(1,4-dioxan-2-yl)ethoxy]-9-(2-propoxyethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 130413276 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[2-(1,4-dioxan-2-yl)ethoxy]-9-(2-propoxyethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | CCCOCCOc1ccc2c(c1)CCn1c-2cc(OCCC2COCCO2)nc1=O |
| InChI | InChI=1S/C23H30N2O6/c1-2-8-27-10-12-29-18-3-4-20-17(14-18)5-7-25-21(20)15-22(24-23(25)26)31-9-6-19-16-28-11-13-30-19/h3-4,14-15,19H,2,5-13,16H2,1H3 |
| InChIKey | UVDWROFRTLEFBQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|