C21H28N8O2 — CID 155126836
N-[4-(cyclopentylamino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidin-5-yl]formamide (PubChem CID 155126836) has the molecular formula C21H28N8O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[4-(cyclopentylamino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidin-5-yl]formamide.
| Compound Name | N-[4-(cyclopentylamino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 155126836 |
| Molecular Formula | C21H28N8O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[4-(cyclopentylamino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidin-5-yl]formamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(Nc3ncc(NC=O)c(NC4CCCC4)n3)cn2)C1 |
| InChI | InChI=1S/C21H28N8O2/c1-2-19(31)28-9-5-8-17(13-28)29-12-16(10-24-29)26-21-22-11-18(23-14-30)20(27-21)25-15-6-3-4-7-15/h2,10-12,14-15,17H,1,3-9,13H2,(H,23,30)(H2,22,25,26,27)/t17-/m1/s1 |
| InChIKey | UAIQRPXLEXQBDY-QGZVFWFLSA-N |
| XLogP | 2.69 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|