C10H11ClFNO — CID 155128144
(3S)-3-[(3-chloro-2-fluorophenyl)methyl]-1,2-oxazolidine (PubChem CID 155128144) has the molecular formula C10H11ClFNO and a molecular weight of 215.66 g/mol. Its IUPAC name is (3S)-3-[(3-chloro-2-fluorophenyl)methyl]-1,2-oxazolidine.
| Compound Name | (3S)-3-[(3-chloro-2-fluorophenyl)methyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 155128144 |
| Molecular Formula | C10H11ClFNO |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | (3S)-3-[(3-chloro-2-fluorophenyl)methyl]-1,2-oxazolidine |
| SMILES | Fc1c(Cl)cccc1C[C@H]1CCON1 |
| InChI | InChI=1S/C10H11ClFNO/c11-9-3-1-2-7(10(9)12)6-8-4-5-14-13-8/h1-3,8,13H,4-6H2/t8-/m1/s1 |
| InChIKey | KBFJOVVFUXICIN-MRVPVSSYSA-N |
| XLogP | 2.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |