C11H14ClNO2 — CID 155128148
(3S)-3-[(3-chloro-2-methoxyphenyl)methyl]-1,2-oxazolidine (PubChem CID 155128148) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is (3S)-3-[(3-chloro-2-methoxyphenyl)methyl]-1,2-oxazolidine.
| Compound Name | (3S)-3-[(3-chloro-2-methoxyphenyl)methyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 155128148 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3S)-3-[(3-chloro-2-methoxyphenyl)methyl]-1,2-oxazolidine |
| SMILES | COc1c(Cl)cccc1C[C@H]1CCON1 |
| InChI | InChI=1S/C11H14ClNO2/c1-14-11-8(3-2-4-10(11)12)7-9-5-6-15-13-9/h2-4,9,13H,5-7H2,1H3/t9-/m1/s1 |
| InChIKey | OSXIAIFJUPWQES-SECBINFHSA-N |
| XLogP | 2.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |