C36H41N5O4 — CID 155128391
5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentanenitrile (PubChem CID 155128391) has the molecular formula C36H41N5O4 and a molecular weight of 607.76 g/mol. Its IUPAC name is 5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentanenitrile.
| Compound Name | 5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentanenitrile |
|---|---|
| PubChem CID | 155128391 |
| Molecular Formula | C36H41N5O4 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentanenitrile |
| SMILES | CCCCc1nc2c(Nc3ccc(OC)cc3OC)nc3cc(CCCCC#N)ccc3c2n1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C36H41N5O4/c1-6-7-12-33-40-34-35(41(33)23-25-14-15-26(42-2)21-31(25)44-4)28-17-13-24(11-9-8-10-19-37)20-30(28)39-36(34)38-29-18-16-27(43-3)22-32(29)45-5/h13-18,20-22H,6-12,23H2,1-5H3,(H,38,39) |
| InChIKey | MHOZBFGFFBZHRI-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|