C38H45N5O6 — CID 164855546
3-[[7-[bis[(2,4-dimethoxyphenyl)methyl]amino]-2-butyl-4-propan-2-yloxyimidazo[4,5-d]pyridazin-3-yl]methyl]benzaldehyde (PubChem CID 164855546) has the molecular formula C38H45N5O6 and a molecular weight of 667.81 g/mol. Its IUPAC name is 3-[[7-[bis[(2,4-dimethoxyphenyl)methyl]amino]-2-butyl-4-propan-2-yloxyimidazo[4,5-d]pyridazin-3-yl]methyl]benzaldehyde.
| Compound Name | 3-[[7-[bis[(2,4-dimethoxyphenyl)methyl]amino]-2-butyl-4-propan-2-yloxyimidazo[4,5-d]pyridazin-3-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 164855546 |
| Molecular Formula | C38H45N5O6 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | 3-[[7-[bis[(2,4-dimethoxyphenyl)methyl]amino]-2-butyl-4-propan-2-yloxyimidazo[4,5-d]pyridazin-3-yl]methyl]benzaldehyde |
| SMILES | CCCCc1nc2c(N(Cc3ccc(OC)cc3OC)Cc3ccc(OC)cc3OC)nnc(OC(C)C)c2n1Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C38H45N5O6/c1-8-9-13-34-39-35-36(43(34)21-26-11-10-12-27(18-26)24-44)38(49-25(2)3)41-40-37(35)42(22-28-14-16-30(45-4)19-32(28)47-6)23-29-15-17-31(46-5)20-33(29)48-7/h10-12,14-20,24-25H,8-9,13,21-23H2,1-7H3 |
| InChIKey | NLFDPHUSJTYIGY-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|