C28H42ClNO2 — CID 155130733
(3S,8R,9S,10S,13S,14S,17S)-17-[4-(6-chloro-2-pyridinyl)-2-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 155130733) has the molecular formula C28H42ClNO2 and a molecular weight of 460.10 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S,17S)-17-[4-(6-chloro-2-pyridinyl)-2-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10S,13S,14S,17S)-17-[4-(6-chloro-2-pyridinyl)-2-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 155130733 |
| Molecular Formula | C28H42ClNO2 |
| Molecular Weight | 460.10 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S,17S)-17-[4-(6-chloro-2-pyridinyl)-2-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(O)(CCc1cccc(Cl)n1)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42ClNO2/c1-26-14-12-20(31)17-18(26)7-8-21-22-9-10-24(27(22,2)15-13-23(21)26)28(3,32)16-11-19-5-4-6-25(29)30-19/h4-6,18,20-24,31-32H,7-17H2,1-3H3/t18?,20-,21-,22-,23-,24-,26-,27-,28?/m0/s1 |
| InChIKey | POAFIJJPKVLTNB-VVSAOEAWSA-N |
| XLogP | 6.44 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.10 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|